For research use only. Not for therapeutic Use.
7-Bromo-4-chloro-2,8-dimethylquinoline(Cat No.:L002316)is a specialized heterocyclic compound widely used in pharmaceutical and chemical research. Featuring bromine and chlorine atoms along with two methyl groups attached to a quinoline ring, this compound is an important intermediate in the synthesis of complex molecules, particularly in drug development. Its unique structure allows for diverse chemical modifications, making it valuable for creating novel therapeutic agents. 7-Bromo-4-chloro-2,8-dimethylquinoline plays a crucial role in high-precision synthesis, supporting advancements in medicinal chemistry and innovative research.
CAS Number | 1189106-62-4 |
Molecular Formula | C11H9BrClN |
Purity | ≥95% |
IUPAC Name | 7-bromo-4-chloro-2,8-dimethylquinoline |
InChI | InChI=1S/C11H9BrClN/c1-6-5-10(13)8-3-4-9(12)7(2)11(8)14-6/h3-5H,1-2H3 |
InChIKey | JJOXAYSGWSYGNB-UHFFFAOYSA-N |
SMILES | CC1=CC(=C2C=CC(=C(C2=N1)C)Br)Cl |