For research use only. Not for therapeutic Use.
7-Bromo-5-chlorobenzofuran is an organic compound characterized by a benzofuran structure with a bromine atom at the seventh position and a chlorine atom at the fifth position. Its chemical formula is C₈H₄BrClO. This compound is of interest in synthetic organic chemistry and materials science due to its potential applications in the development of pharmaceuticals and agrochemicals. The presence of halogen substituents enhances its reactivity, making it suitable for various chemical transformations and providing opportunities for further functionalization in research.
CAS Number | 286836-07-5 |
Molecular Formula | C8H4BrClO |
Purity | ≥95% |
IUPAC Name | 7-bromo-5-chloro-1-benzofuran |
InChI | InChI=1S/C8H4BrClO/c9-7-4-6(10)3-5-1-2-11-8(5)7/h1-4H |
InChIKey | RPFUTTNAUKQRAC-UHFFFAOYSA-N |
SMILES | C1=COC2=C(C=C(C=C21)Cl)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |