For research use only. Not for therapeutic Use.
7-Bromo-6-chloro-4(3H)-quinazolinone(Cat No.:R008770), is a chemical compound with the molecular formula C8H4BrClN2O. It features a quinazolinone ring structure with both a bromine atom and a chlorine atom attached. This compound’s structure suggests its potential applications in organic synthesis, particularly as a building block for creating diverse molecules. The presence of the bromine and chlorine atoms on the quinazolinone ring can impact its reactivity, making it valuable for preparing specialized compounds used in pharmaceuticals, agrochemicals, and other fine chemicals.
Catalog Number | R008770 |
CAS Number | 17518-98-8 |
Synonyms | 7-Bromo-6-chloro-4(1H)-quinazolinone |
Molecular Formula | C8H4BrClN2O |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 7-bromo-6-chloro-1H-quinazolin-4-one |
InChI | InChI=1S/C8H4BrClN2O/c9-5-2-7-4(1-6(5)10)8(13)12-3-11-7/h1-3H,(H,11,12,13) |
InChIKey | RFCXXKWROOFQSI-UHFFFAOYSA-N |
SMILES | C1=C2C(=CC(=C1Cl)Br)NC=NC2=O |