For research use only. Not for therapeutic Use.
7-Bromocinnoline is a halogenated derivative of cinnoline, featuring a bromine atom at the 7th position of the cinnoline ring structure. Cinnoline compounds are nitrogen-containing heterocycles that are commonly used in medicinal and organic chemistry due to their potential biological activities. The bromine substituent enhances its reactivity, allowing for further chemical modifications, such as cross-coupling reactions. Researchers explore 7-bromocinnoline in drug discovery and development, particularly for its applications in creating new therapeutic agents with antimicrobial, anticancer, or anti-inflammatory properties.
CAS Number | 1375108-47-6 |
Molecular Formula | C8H5BrN2 |
Purity | ≥95% |
IUPAC Name | 7-bromocinnoline |
InChI | InChI=1S/C8H5BrN2/c9-7-2-1-6-3-4-10-11-8(6)5-7/h1-5H |
InChIKey | YSQZCVRMDQNMSE-UHFFFAOYSA-N |
SMILES | C1=CC(=CC2=C1C=CN=N2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |