For research use only. Not for therapeutic Use.
7-Bromotetralone is an aromatic compound characterized by a bromine substituent on the tetralone structure. This compound is of interest in organic synthesis due to its potential applications in the development of pharmaceuticals and agrochemicals. The bromine atom enhances its reactivity, allowing for diverse chemical transformations such as nucleophilic substitutions and coupling reactions. Researchers investigate its biological activities, including possible antimicrobial and anticancer properties, making it a valuable scaffold for synthesizing novel therapeutic agents in medicinal chemistry.
CAS Number | 32281-97-3 |
Synonyms | NSC 74917 |
Molecular Formula | C10H9BrO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 7-bromo-3,4-dihydro-2H-naphthalen-1-one |
InChI | InChI=1S/C10H9BrO/c11-8-5-4-7-2-1-3-10(12)9(7)6-8/h4-6H,1-3H2 |
InChIKey | YGVDCGFUUUJCDF-UHFFFAOYSA-N |
SMILES | C1CC2=C(C=C(C=C2)Br)C(=O)C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |