For research use only. Not for therapeutic Use.
7-Chloro-1-methyl-5-phenyl-[1,2,4]triazolo[4,3-a]quinolin-4-amine is a synthetic chemical compound often investigated for its potential pharmacological properties. This compound’s unique triazoloquinoline structure suggests possible applications in medicinal chemistry, including potential use as an anxiolytic or antidepressant. Its structure allows for interactions with specific neurotransmitter receptors in the brain, which could modulate mood and anxiety. Ongoing research aims to explore its efficacy, safety, and therapeutic potential in clinical settings.
CAS Number | 448950-89-8 |
Molecular Formula | C17H13ClN4 |
Purity | ≥95% |
Storage | -20 ℃ |
IUPAC Name | 7-chloro-1-methyl-5-phenyl-[1,2,4]triazolo[4,3-a]quinolin-4-amine |
InChI | InChI=1S/C17H13ClN4/c1-10-20-21-17-16(19)15(11-5-3-2-4-6-11)13-9-12(18)7-8-14(13)22(10)17/h2-9H,19H2,1H3 |
InChIKey | UZCOFCPJYLEACT-UHFFFAOYSA-N |
SMILES | CC1=NN=C2N1C3=C(C=C(C=C3)Cl)C(=C2N)C4=CC=CC=C4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |