For research use only. Not for therapeutic Use.
7-Chloro-1H-indole-4-carboxylic acid is a chlorinated indole derivative commonly used in pharmaceutical research and organic synthesis. With its unique structure featuring both a chloro and a carboxylic acid group on an indole ring, this compound serves as a versatile intermediate in the synthesis of bioactive molecules. It is particularly valuable in drug discovery, where it aids in developing compounds with potential therapeutic effects, such as anti-inflammatory or anticancer activities. Its structure supports modifications for targeted medicinal applications.
CAS Number | 588688-45-3 |
Molecular Formula | C9H6ClNO2 |
Purity | ≥95% |
IUPAC Name | 7-chloro-1H-indole-4-carboxylic acid |
InChI | InChI=1S/C9H6ClNO2/c10-7-2-1-6(9(12)13)5-3-4-11-8(5)7/h1-4,11H,(H,12,13) |
InChIKey | FKMNAVDJNRMGHP-UHFFFAOYSA-N |
SMILES | C1=CC(=C2C(=C1C(=O)O)C=CN2)Cl |