For research use only. Not for therapeutic Use.
7-Chloro-2-oxo-2H-chromene-3-carboxylic acid(Cat No.:L022623)is a chlorinated coumarin derivative, notable for its oxo group and a carboxylic acid functionality on the chromene ring. This compound is a key intermediate in the synthesis of diverse organic molecules, particularly in creating pharmaceuticals and dyes. The carboxylic acid group enhances solubility and reactivity, facilitating esterification and other derivatization processes. Its unique structure lends itself to the development of anticoagulant and antimicrobial agents. 7-Chloro-2-oxo-2H-chromene-3-carboxylic acid is crucial for advancing new treatments that exploit the biological activities of coumarins.
CAS Number | 20300-58-7 |
Molecular Formula | C10H5ClO4 |
Purity | ≥95% |
IUPAC Name | 7-chloro-2-oxochromene-3-carboxylic acid |
InChI | InChI=1S/C10H5ClO4/c11-6-2-1-5-3-7(9(12)13)10(14)15-8(5)4-6/h1-4H,(H,12,13) |
InChIKey | ATWKNGBPIMPABJ-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1Cl)OC(=O)C(=C2)C(=O)O |