For research use only. Not for therapeutic Use.
7-Chloro-5-fluoroindoline-2,3-dione is a heterocyclic compound characterized by an indoline structure with a chlorine atom at the 7-position and a fluorine atom at the 5-position. The presence of the dione functional groups at the 2 and 3 positions enhances its reactivity and potential biological activity, making it of interest in medicinal chemistry. This compound may serve as a scaffold for developing novel pharmaceuticals, with its unique electronic properties allowing for various modifications and exploration of structure-activity relationships in drug discovery.
CAS Number | 259860-03-2 |
Molecular Formula | C8H3ClFNO2 |
Purity | ≥95% |
IUPAC Name | 7-chloro-5-fluoro-1H-indole-2,3-dione |
InChI | InChI=1S/C8H3ClFNO2/c9-5-2-3(10)1-4-6(5)11-8(13)7(4)12/h1-2H,(H,11,12,13) |
InChIKey | CRNNFZRMOHSUJH-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C2=C1C(=O)C(=O)N2)Cl)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |