For research use only. Not for therapeutic Use.
7-Chloro-6-methoxyquinazolin-4(3H)-one(Cat No.:L020755)is a heterocyclic compound used in pharmaceutical research and organic synthesis. The quinazolinone core, substituted with a chlorine atom at the 7-position and a methoxy group at the 6-position, provides unique reactivity and biological activity. This compound is valuable as an intermediate in the synthesis of kinase inhibitors and other biologically active molecules. Its structure allows for versatile chemical modifications, making it essential for developing potential therapeutic agents. Researchers use this compound in drug discovery, particularly in oncology and central nervous system research.
CAS Number | 858238-17-2 |
Molecular Formula | C9H7ClN2O2 |
Purity | ≥95% |
IUPAC Name | 7-chloro-6-methoxy-3H-quinazolin-4-one |
InChI | InChI=1S/C9H7ClN2O2/c1-14-8-2-5-7(3-6(8)10)11-4-12-9(5)13/h2-4H,1H3,(H,11,12,13) |
InChIKey | WXKMNWBPCZFSST-UHFFFAOYSA-N |
SMILES | COC1=C(C=C2C(=C1)C(=O)NC=N2)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |