Home
>
Chemical Reagents>Heterocyclic Building Blocks> 7-Chloro-8-fluoropyrido[4,3-d]pyrimidine-2,4(1H,3H)-dione
For research use only. Not for therapeutic Use.
7-Chloro-8-fluoropyrido[4,3-d]pyrimidine-2,4(1H,3H)-dione(CAT: L000325) plays a crucial role in the fields of organic and pharmaceutical chemistry. This chemical acts as a key intermediate for the synthesis of pharmaceutical compounds, particularly those designed for their potential in treating a range of diseases. Its primary target is the development of novel drug candidates with applications in therapeutic areas such as oncology and inflammation.
Catalog Number | L000325 |
CAS Number | 2454397-75-0 |
Molecular Formula | C7H3ClFN3O2 |
Purity | ≥95% |
IUPAC Name | 7-chloro-8-fluoro-1H-pyrido[4,3-d]pyrimidine-2,4-dione |
InChI | InChI=1S/C7H3ClFN3O2/c8-5-3(9)4-2(1-10-5)6(13)12-7(14)11-4/h1H,(H2,11,12,13,14) |
InChIKey | UQERDTKJRJNCHD-UHFFFAOYSA-N |