For research use only. Not for therapeutic Use.
7-Chlorodibenzo[c,h]acridine (Cat.No:L003415) is a crucial chemical compound in organic synthesis. Its distinctive fused-ring structure makes it a valuable building block for the preparation of specialized materials. This compound’s reactivity and versatility render it indispensable in the development of various functional molecules, highlighting its significance in contemporary chemical research and materials science.
CAS Number | 859745-06-5 |
Molecular Formula | C21H12ClN |
Purity | ≥95% |
IUPAC Name | 13-chloro-2-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,10,13,15,17,19,21-undecaene |
InChI | InChI=1S/C21H12ClN/c22-19-17-11-9-13-5-1-3-7-15(13)20(17)23-21-16-8-4-2-6-14(16)10-12-18(19)21/h1-12H |
InChIKey | KXAUQHJDRHPCPU-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=CC3=C2N=C4C(=C3Cl)C=CC5=CC=CC=C54 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |