For research use only. Not for therapeutic Use.
7-Chloropyrido[3,4-b]pyrazine is a chlorinated heterocyclic compound widely used in pharmaceutical research and synthesis. This compound serves as a versatile building block in drug discovery, particularly in the development of kinase inhibitors and other bioactive molecules. With its distinctive pyridopyrazine structure, it supports structural diversity in compound libraries, enabling the exploration of new therapeutic pathways. Its applications extend to medicinal chemistry and material sciences, where it aids in crafting targeted molecules for various research initiatives.
CAS Number | 93049-39-9 |
Molecular Formula | C7H4ClN3 |
Purity | ≥95% |
IUPAC Name | 7-chloropyrido[3,4-b]pyrazine |
InChI | InChI=1S/C7H4ClN3/c8-7-3-5-6(4-11-7)10-2-1-9-5/h1-4H |
InChIKey | JZAAFHCCXSMDIE-UHFFFAOYSA-N |
SMILES | C1=CN=C2C=NC(=CC2=N1)Cl |