For research use only. Not for therapeutic Use.
7-Chlorothieno[2,3-c]pyridine is a heterocyclic compound featuring a fused thieno-pyridine ring system with a chlorine atom at the 7-position. It is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The thieno[2,3-c]pyridine structure imparts significant bioactivity, making it valuable in the development of drug candidates targeting various biological pathways. Its unique chemical properties allow for the creation of compounds with potential applications in cancer treatment, inflammatory diseases, and other therapeutic areas. Researchers utilize this compound for its reactivity and structural versatility in medicinal chemistry and chemical biology.
CAS Number | 28948-58-5 |
Synonyms | 7-chloro-thieno[2,3-c]pyridine |
Molecular Formula | C7H4ClNS |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 7-chlorothieno[2,3-c]pyridine |
InChI | InChI=1S/C7H4ClNS/c8-7-6-5(1-3-9-7)2-4-10-6/h1-4H |
InChIKey | HRHLEPHFARWKKU-UHFFFAOYSA-N |
SMILES | C1=CN=C(C2=C1C=CS2)Cl |