For research use only. Not for therapeutic Use.
7-Chlorotryptophan(Cat No.:M071114), is a derivative of the amino acid tryptophan, featuring a chlorine atom attached to the seventh carbon position of the tryptophan backbone. This compound’s structure signifies its potential applications in various chemical and biochemical contexts. The presence of the chlorine atom on the tryptophan structure can influence its reactivity, making it valuable for creating specialized molecules for research purposes, such as studying protein modifications or understanding enzyme catalysis, and potentially in the development of new therapeutic agents.
CAS Number | 153-97-9 |
Molecular Formula | C11H11ClN2O2 |
Purity | ≥95% |
Storage | 2-8°C(protect from light) |
IUPAC Name | 2-amino-3-(7-chloro-1H-indol-3-yl)propanoic acid |
InChI | InChI=1S/C11H11ClN2O2/c12-8-3-1-2-7-6(5-14-10(7)8)4-9(13)11(15)16/h1-3,5,9,14H,4,13H2,(H,15,16) |
InChIKey | DMQFGLHRDFQKNR-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C(=C1)Cl)NC=C2CC(C(=O)O)N |