For research use only. Not for therapeutic Use.
7-Deaza-2′-deoxyguanosine (7-Deaza-2′-dG)(Cat No.:L047465)is a modified nucleoside analog of deoxyguanosine, where the nitrogen atom at the 7 position of the purine ring is replaced with a carbon. This modification enhances its stability and alters its interactions during DNA synthesis, making it a useful tool in molecular biology and medicinal chemistry. 7-Deaza-2′-dG is often incorporated into oligonucleotides to study DNA structure, function, and interactions, as well as to investigate the effects of guanine modifications on DNA replication and repair processes. Its potential therapeutic applications in cancer and antiviral treatments are also being explored.
CAS Number | 86392-75-8 |
Molecular Formula | C11H14N4O4 |
Purity | ≥95% |
IUPAC Name | 2-amino-7-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one |
InChI | InChI=1S/C11H14N4O4/c12-11-13-9-5(10(18)14-11)1-2-15(9)8-3-6(17)7(4-16)19-8/h1-2,6-8,16-17H,3-4H2,(H3,12,13,14,18)/t6-,7+,8+/m0/s1 |
InChIKey | PFCLMNDDPTZJHQ-XLPZGREQSA-N |
SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC3=C2N=C(NC3=O)N)CO)O |