For research use only. Not for therapeutic Use.
7-Deazainosine is a biochemical.
| Catalog Number | I021014 |
| CAS Number | 2862-16-0 |
| Synonyms | 7-Deazainosine; Deaminohydroxytubercindin; 7 Deazainosine; 7Deazainosine. |
| Molecular Formula | C11H13N3O5 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 4H-Pyrrolo(2,3-d)pyrimidin-4-one, 1,7-dihydro-7-beta-D-ribofuranosyl- (8CI)(9CI) |
| InChI | InChI=1S/C11H13N3O5/c15-3-6-7(16)8(17)11(19-6)14-2-1-5-9(14)12-4-13-10(5)18/h1-2,4,6-8,11,15-17H,3H2,(H,12,13,18)/t6-,7-,8-,11-/m1/s1 |
| InChIKey | DPRSKJHWKNHBOW-KCGFPETGSA-N |
| SMILES | O=C1C2=C(N([C@H]3[C@@H]([C@@H]([C@@H](CO)O3)O)O)C=C2)NC=N1 |
