For research use only. Not for therapeutic Use.
7-Fluoro-1,5-naphthyridin-3-amine is a heterocyclic compound featuring a naphthyridine core with a fluorine atom at the 7-position and an amino group at the 3-position. This compound is of interest in medicinal chemistry for its potential biological activities, including antimicrobial and anticancer properties. The fluorine substitution enhances lipophilicity and metabolic stability, making it suitable for drug development. Its structure allows for further modifications, contributing to the synthesis of novel therapeutic agents and the exploration of various chemical applications.
CAS Number | 2089650-61-1 |
Molecular Formula | C8H6FN3 |
Purity | ≥95% |
IUPAC Name | 7-fluoro-1,5-naphthyridin-3-amine |
InChI | InChI=1S/C8H6FN3/c9-5-1-7-8(11-3-5)2-6(10)4-12-7/h1-4H,10H2 |
InChIKey | JDITXLFDHDBEPS-UHFFFAOYSA-N |
SMILES | C1=C(C=NC2=C1N=CC(=C2)F)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |