For research use only. Not for therapeutic Use.
(7-Fluoro-2-methylquinolin-8-yl)boronic acid(Cat No.:L037542)is a boronic acid derivative featuring a fluorine atom at the 7-position and a methyl group at the 2-position of the quinoline ring. This compound is commonly used as a key intermediate in organic synthesis, particularly in the development of pharmaceuticals and advanced materials. The boronic acid group allows for versatile cross-coupling reactions, such as Suzuki-Miyaura coupling, making it valuable for creating complex molecules, including potential drug candidates. Its unique structure and reactivity make it an essential building block in medicinal chemistry and chemical research.
CAS Number | 1072945-61-9 |
Molecular Formula | C10H9BFNO2 |
Purity | ≥95% |
IUPAC Name | (7-fluoro-2-methylquinolin-8-yl)boronic acid |
InChI | InChI=1S/C10H9BFNO2/c1-6-2-3-7-4-5-8(12)9(11(14)15)10(7)13-6/h2-5,14-15H,1H3 |
InChIKey | JJUDZBZHUSMGRX-UHFFFAOYSA-N |
SMILES | B(C1=C(C=CC2=C1N=C(C=C2)C)F)(O)O |