For research use only. Not for therapeutic Use.
7-Fluoro-3-iodoimidazo[1,2-a]pyridine(Cat No.:L016259)is a valuable intermediate in pharmaceutical research, particularly in the synthesis of bioactive compounds targeting neurological and oncological pathways. The presence of both fluoro and iodo groups enhances its reactivity and allows for versatile chemical modifications, making it an essential building block for creating complex molecules with potential therapeutic applications. This compound’s imidazo[1,2-a]pyridine core is known for its biological activity, making it a crucial tool for medicinal chemists exploring new drug candidates and optimizing lead compounds in drug discovery.
CAS Number | 2089326-83-8 |
Molecular Formula | C7H4FIN2 |
Purity | ≥95% |
IUPAC Name | 7-fluoro-3-iodoimidazo[1,2-a]pyridine |
InChI | InChI=1S/C7H4FIN2/c8-5-1-2-11-6(9)4-10-7(11)3-5/h1-4H |
InChIKey | BWGBEPCWEKJWTK-UHFFFAOYSA-N |
SMILES | C1=CN2C(=NC=C2I)C=C1F |