For research use only. Not for therapeutic Use.
7-Fluoro-8-methylquinolin-4(1H)-one(Cat No.:L007314), is a chemical compound with important applications in medicinal chemistry and pharmaceutical research. It features a quinoline scaffold with a fluoro substitution at the 7th position and a methyl group at the 8th position, making it a valuable intermediate in the synthesis of bioactive molecules. Researchers often utilize this compound as a key building block in the development of novel drugs, especially in the field of anti-cancer and anti-inflammatory drug discovery. Its unique structure and reactivity make it an essential tool for medicinal chemists aiming to create targeted therapies and explore new avenues in pharmacological research.
CAS Number | 1065092-79-6 |
Molecular Formula | C10H8FNO |
Purity | ≥95% |
IUPAC Name | 7-fluoro-8-methyl-1H-quinolin-4-one |
InChI | InChI=1S/C10H8FNO/c1-6-8(11)3-2-7-9(13)4-5-12-10(6)7/h2-5H,1H3,(H,12,13) |
InChIKey | YFRBPOCEBRYGSG-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC2=C1NC=CC2=O)F |