For research use only. Not for therapeutic Use.
7-Fluoroquinolin-4-amine(CAT: L021278) is a high-purity heterocyclic compound featuring a fluorine atom at the 7th position and an amine group at the 4th position of the quinoline scaffold. This versatile molecule is widely used as a key intermediate in pharmaceutical research, particularly in the synthesis of bioactive quinoline derivatives. It plays a significant role in the development of antimicrobial, anticancer, and anti-inflammatory agents. Known for its stability and reactivity, 7-Fluoroquinolin-4-amine is an essential building block for innovative drug discovery and chemical synthesis, supporting advancements in medicinal chemistry and fine chemical production.
CAS Number | 948293-49-0 |
Molecular Formula | C9H7FN2 |
Purity | ≥95% |
IUPAC Name | 7-fluoroquinolin-4-amine |
InChI | InChI=1S/C9H7FN2/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5H,(H2,11,12) |
InChIKey | LTTMOJNRHULDIW-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CN=C2C=C1F)N |