For research use only. Not for therapeutic Use.
7-Hydroxy Coumarin-d5 is a deuterated derivative of 7-Hydroxy Coumarin, featuring five deuterium atoms. This compound is essential for advanced pharmaceutical research, particularly in drug metabolism studies, as it allows for precise tracking of metabolic pathways. Its stable isotope labeling provides enhanced accuracy in mass spectrometry analysis, making it a valuable tool for pharmacokinetics and biochemical assays. Ideal for researchers requiring high-purity compounds, 7-Hydroxy Coumarin-d5 integrates seamlessly into complex experimental protocols.
CAS Number | 1215373-23-1 |
Synonyms | 7-Hydroxy-2H-1-benzopyran-2-one-d5; 7-Hydroxy-2-chromenone-d5; 7-Oxycoumarin-d5; Hydrangin-d5; Hydrangine-d5; NSC 19790-d5; Skimmetin-d5; Skimmetine-d5; Umbelliferone-d5; |
Molecular Formula | C9H6O3 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | 3,4,5,6,8-pentadeuterio-7-hydroxychromen-2-one |
InChI | InChI=1S/C9H6O3/c10-7-3-1-6-2-4-9(11)12-8(6)5-7/h1-5,10H/i1D,2D,3D,4D,5D |
InChIKey | ORHBXUUXSCNDEV-RALIUCGRSA-N |
SMILES | C1=CC(=CC2=C1C=CC(=O)O2)O |