For research use only. Not for therapeutic Use.
7-Iodoimidazo[1,2-a]pyridine(Cat No.:L036481)is a heterocyclic compound commonly used as a key intermediate in pharmaceutical and chemical research. Featuring an iodine atom at the 7-position of the imidazo[1,2-a]pyridine ring system, this compound is particularly valuable for cross-coupling reactions and other modifications in organic synthesis. It plays a crucial role in the development of bioactive molecules, including potential therapeutic agents targeting various biological pathways. Its reactivity and versatile structure make it a vital building block in drug discovery, medicinal chemistry, and the synthesis of advanced materials.
CAS Number | 908269-30-7 |
Molecular Formula | C7H5IN2 |
Purity | ≥95% |
IUPAC Name | 7-iodoimidazo[1,2-a]pyridine |
InChI | InChI=1S/C7H5IN2/c8-6-1-3-10-4-2-9-7(10)5-6/h1-5H |
InChIKey | LXPYXLTZQOLCIZ-UHFFFAOYSA-N |
SMILES | C1=CN2C=CN=C2C=C1I |