Home
>
Chemical Reagents>Heterocyclic Building Blocks> 7-Methanesulfonyl-1,2,3,4-tetrahydroquinoline
For research use only. Not for therapeutic Use.
7-Methanesulfonyl-1,2,3,4-tetrahydroquinoline(Cat No.:L007567), is a chemical compound notable for its tetrahydroquinoline backbone with a methanesulfonyl group attached at the seventh position. This unique molecular structure is of interest in medicinal chemistry and organic synthesis. Scientists explore its potential biological activities and reactivity, making it valuable in drug discovery efforts. Compounds with similar scaffolds often serve as intermediates in pharmaceutical research, enabling the synthesis of diverse molecules. Its distinct structure allows for various modifications, facilitating the creation of new compounds with specific properties, and contributing significantly to the development of novel drugs and research chemicals.
CAS Number | 1240526-05-9 |
Molecular Formula | C10H13NO2S |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 7-methylsulfonyl-1,2,3,4-tetrahydroquinoline |
InChI | InChI=1S/C10H13NO2S/c1-14(12,13)9-5-4-8-3-2-6-11-10(8)7-9/h4-5,7,11H,2-3,6H2,1H3 |
InChIKey | JIRLKZNBXVTGIF-UHFFFAOYSA-N |
SMILES | CS(=O)(=O)C1=CC2=C(CCCN2)C=C1 |