For research use only. Not for therapeutic Use.
7-Methoxy-1-naphthalenol is an organic compound used in chemical synthesis and pharmaceutical research. Known for its aromatic structure, it serves as an intermediate in the production of various biologically active molecules and pharmaceuticals. This compound is essential for studying chemical reaction mechanisms, developing synthetic methodologies, and exploring potential therapeutic applications. Researchers rely on 7-Methoxy-1-naphthalenol for precise and reliable results in advanced organic chemistry and drug development, contributing significantly to innovations in medicinal chemistry and synthetic processes.
CAS Number | 67247-13-6 |
Synonyms | 1-Hydroxy-7-methoxynaphthalene; 7-Methoxy-1-naphthol; |
Molecular Formula | C11H10O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 7-methoxynaphthalen-1-ol |
InChI | InChI=1S/C11H10O2/c1-13-9-6-5-8-3-2-4-11(12)10(8)7-9/h2-7,12H,1H3 |
InChIKey | KUKJAAZDXZNNPD-UHFFFAOYSA-N |
SMILES | COC1=CC2=C(C=CC=C2O)C=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |