For research use only. Not for therapeutic Use.
7-Methoxy-2-naphthol is a derivative of naphthol, featuring a methoxy group at the 7th position and a hydroxyl group at the 2nd position on a naphthalene ring. This compound is of interest in organic synthesis and medicinal chemistry due to its reactive hydroxyl group, which allows for further functionalization. It is often used as a building block in the development of pharmaceuticals, dyes, and other organic compounds. Researchers explore its potential applications in drug design and as an intermediate for bioactive molecules.
| CAS Number | 5060-82-2 |
| Synonyms | 2-Hydroxy-7-methoxynaphthalene; 3-Methoxy-6-naphthol; 7-Methoxy-2-naphthalenol; 7-Methoxy-2-naphthol; 7-Methoxy-β-naphthol; |
| Molecular Formula | C11H10O2 |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | 7-methoxynaphthalen-2-ol |
| InChI | InChI=1S/C11H10O2/c1-13-11-5-3-8-2-4-10(12)6-9(8)7-11/h2-7,12H,1H3 |
| InChIKey | UNFNRIIETORURP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CC(=C2)O)C=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
