For research use only. Not for therapeutic Use.
7-Methoxy-2-oxo-2H-chromene-3-carboxylic acid(Cat No.:L047441)is a coumarin derivative featuring a methoxy group at the 7-position and a carboxylic acid at the 3-position of the chromene ring. This compound is commonly used in pharmaceutical research and organic synthesis as a building block for the development of biologically active molecules, including potential drug candidates. Its coumarin core offers unique bioactivity, making it valuable in the exploration of anticoagulants, anti-inflammatory agents, and other therapeutic agents. Researchers in medicinal chemistry utilize this compound to explore innovative therapeutic pathways and drug development.
CAS Number | 20300-59-8 |
Molecular Formula | C11H8O5 |
Purity | ≥95% |
IUPAC Name | 7-methoxy-2-oxochromene-3-carboxylic acid |
InChI | InChI=1S/C11H8O5/c1-15-7-3-2-6-4-8(10(12)13)11(14)16-9(6)5-7/h2-5H,1H3,(H,12,13) |
InChIKey | VEEGNDSSWAOLFN-UHFFFAOYSA-N |
SMILES | COC1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)O |