For research use only. Not for therapeutic Use.
7-Methoxy-4-methylcoumarin(Cat No.:R000198)is a synthetic coumarin derivative commonly used in biochemical and fluorescence-based research due to its strong fluorescent properties. This compound absorbs ultraviolet light and emits blue fluorescence, making it ideal as a fluorescent probe in enzyme assays, particularly for studying esterases and hydrolases. Additionally, 7-Methoxy-4-methylcoumarin is used in photochemical research to investigate light-induced reactions. Its stability, sensitivity, and compatibility with various solvents make it a versatile tool for fluorescence applications, enabling precise monitoring of biological and chemical processes in scientific research.
CAS Number | 2555-28-4 |
Synonyms | 7-Methoxy-4-methyl-2H-1-benzopyran-2-one; 4-Methyl-herniarin; 4-Methylumbelliferone Methyl Ether; 7-Methoxy-4-methyl-2H-chromen-2-one; NSC 688805; |
Molecular Formula | C11H10O3 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | 7-methoxy-4-methylchromen-2-one |
InChI | InChI=1S/C11H10O3/c1-7-5-11(12)14-10-6-8(13-2)3-4-9(7)10/h3-6H,1-2H3 |
InChIKey | UDFPKNSWSYBIHO-UHFFFAOYSA-N |
SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |