For research use only. Not for therapeutic Use.
7-Methoxyflavone（Cat No.:I021020）is a naturally occurring flavonoid compound found in various plants, including certain species of Ilex and Citrus. It features a methoxy group (-OCH3) at the 7-position of the flavone structure. Known for its antioxidant, anti-inflammatory, and anticancer properties, 7-methoxyflavone has been studied for its potential therapeutic benefits in various health conditions. It has demonstrated promise in modulating cellular signaling pathways, inhibiting oxidative stress, and regulating enzymes linked to cancer progression and inflammation. This compound holds potential for applications in drug development and natural health supplements.
| CAS Number | 22395-22-8 |
| Synonyms | 7-methoxy-2-phenylchromen-4-one |
| Molecular Formula | C16H12O3 |
| Purity | ≥95% |
| IUPAC Name | 7-methoxy-2-phenylchromen-4-one |
| InChI | InChI=1S/C16H12O3/c1-18-12-7-8-13-14(17)10-15(19-16(13)9-12)11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | QKNDCRMJDZLFEG-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)C=C(O2)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
