For research use only. Not for therapeutic Use.
7-methyl-5-nitro-1H-indole (Cat.No:L003459) is a vital chemical compound with diverse applications in pharmaceutical and agrochemical research. Its distinctive structure, characterized by a methyl and nitro group on an indole ring, makes it a key building block in the synthesis of various biologically active compounds. This compound’s versatility and significance in drug discovery highlight its importance in the development of innovative pharmaceuticals and crop protection agents.
CAS Number | 10553-08-9 |
Molecular Formula | C9H8N2O2 |
Purity | ≥95% |
IUPAC Name | 7-methyl-5-nitro-1H-indole |
InChI | InChI=1S/C9H8N2O2/c1-6-4-8(11(12)13)5-7-2-3-10-9(6)7/h2-5,10H,1H3 |
InChIKey | BGLMRHYPBSQOTA-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC2=C1NC=C2)[N+](=O)[O-] |