For research use only. Not for therapeutic Use.
<span style="color:#000000;"><span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;">7-Methyl Memantine Hydrochloride (CAS 15210-60-3) <span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">is an impurity of Memantine (HCl salt, M218000) which is used as an antiparkinsonian and antispasmodic.</span></span></span></span>
| Catalog Number | R045659 |
| CAS Number | 15210-60-3 |
| Synonyms | 3,5,7-Trimethyl-tricyclo[3.3.1.13,7]decan-1-amine Hydrochloride;?3,5,7-Trimethyl-1-adamantanamine Hydrochloride; 3,5,7-Trimethyl-tricyclo[3.3.1.13,7]decan-1-amine Hydrochloride |
| Molecular Formula | C13H24ClN |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3,5,7-trimethyladamantan-1-amine;hydrochloride |
| InChI | InChI=1S/C13H23N.ClH/c1-10-4-11(2)6-12(3,5-10)9-13(14,7-10)8-11;/h4-9,14H2,1-3H3;1H |
| InChIKey | HOZQWSJTVWTWDT-UHFFFAOYSA-N |
| SMILES | CC12CC3(CC(C1)(CC(C2)(C3)N)C)C.Cl |
| Reference | <span style="color:#000000;"><span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;">1.<span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">Rohde, H. "Results of clinical trials of the antispasmodic agent memantine." </span><i style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Fortschritte der Medizin</i><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;"> 100.43 (1982): 2023.<br /> |
