For research use only. Not for therapeutic Use.
7-(Methylsulfonyl)-2,3-dihydro-1,4-benzodioxin-6-amine（Cat No.:L007498）, is a chemical compound with a unique molecular structure. It contains a benzodioxin ring fused with a dihydrofuran ring, an amine group, and a methylsulfanyl (methylthio) substituent. This compound is significant in medicinal chemistry and drug discovery, where researchers investigate its potential biological activities and interactions. The compound’s structural features make it valuable for exploring new therapeutic avenues.
| CAS Number | 1183512-25-5 |
| Molecular Formula | C9H11NO2S |
| Purity | ≥95% |
| IUPAC Name | 6-methylsulfanyl-2,3-dihydro-1,4-benzodioxin-7-amine |
| InChI | InChI=1S/C9H11NO2S/c1-13-9-5-8-7(4-6(9)10)11-2-3-12-8/h4-5H,2-3,10H2,1H3 |
| InChIKey | BOXXRJVACCXEKH-UHFFFAOYSA-N |
| SMILES | CSC1=CC2=C(C=C1N)OCCO2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
