For research use only. Not for therapeutic Use.
7-Nitro-3,4-dihydroisoquinoline(Cat No.:L047430)is a nitrogen-containing heterocyclic compound widely used in pharmaceutical and chemical research. Featuring a nitro group at the 7-position of the dihydroisoquinoline ring, this compound is valuable for developing bioactive molecules, particularly in the synthesis of potential therapeutic agents. Its unique structure makes it useful in the exploration of new chemical reactions and pathways, contributing to advancements in medicinal chemistry. 7-Nitro-3,4-dihydroisoquinoline is essential in synthesizing complex molecular frameworks, aiding in drug discovery and the development of novel compounds.
CAS Number | 62541-59-7 |
Molecular Formula | C9H8N2O2 |
Purity | ≥95% |
IUPAC Name | 7-nitro-3,4-dihydroisoquinoline |
InChI | InChI=1S/C9H8N2O2/c12-11(13)9-2-1-7-3-4-10-6-8(7)5-9/h1-2,5-6H,3-4H2 |
InChIKey | GVHORNVRKMSZLA-UHFFFAOYSA-N |
SMILES | C1CN=CC2=C1C=CC(=C2)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |