For research use only. Not for therapeutic Use.
7-Nitroindoline hydrochloride(Cat No.:L010249)is a specialized compound used in pharmaceutical research and organic synthesis. Featuring a nitro group on the indoline ring, this compound is a key intermediate in the development of various bioactive molecules, including potential drug candidates. The hydrochloride salt form enhances its solubility and stability, making it suitable for various chemical transformations. Its structure allows for targeted modifications, making it valuable in medicinal chemistry for the synthesis of complex heterocyclic compounds.
CAS Number | 2173992-22-6 |
Molecular Formula | C8H9ClN2O2 |
Purity | ≥95% |
IUPAC Name | 7-nitro-2,3-dihydro-1H-indole;hydrochloride |
InChI | InChI=1S/C8H8N2O2.ClH/c11-10(12)7-3-1-2-6-4-5-9-8(6)7;/h1-3,9H,4-5H2;1H |
InChIKey | VZHMOVIJXOLTKW-UHFFFAOYSA-N |
SMILES | C1CNC2=C1C=CC=C2[N+](=O)[O-].Cl |