For research use only. Not for therapeutic Use.
7-O-Methyleriodictyol is a flavonoid compound found in certain plants like parsley and citrus fruits. It is structurally related to the flavonoid eriodictyol, with a methyl group attached to the hydroxyl group at position 7. 7-O-Methyleriodictyol exhibits antioxidant and anti-inflammatory properties and may have potential health benefits, including cardiovascular protection and anti-cancer effects. Research on this compound focuses on its bioavailability, physiological effects, and therapeutic potential, particularly in the context of dietary interventions and natural medicine.
| CAS Number | 51857-11-5 |
| Molecular Formula | C16H14O6 |
| Purity | ≥95% |
| Target | Plants |
| Appearance | Powder |
| Storage | -20°C |
| IUPAC Name | (2S)-2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C16H14O6/c1-21-9-5-12(19)16-13(20)7-14(22-15(16)6-9)8-2-3-10(17)11(18)4-8/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1 |
| InChIKey | DSAJORLEPQBKDA-AWEZNQCLSA-N |
| SMILES | COC1=CC(=C2C(=O)CC(OC2=C1)C3=CC(=C(C=C3)O)O)O |
