For research use only. Not for therapeutic Use.
7-Pentadecanol(Cat No.:L007495), is a long-chain fatty alcohol with a 15-carbon backbone. Its molecular structure consists of a hydrophilic alcohol group and a hydrophobic alkyl chain. Fatty alcohols like pentadecanol find applications in various industries, including cosmetics, where they are used as emollients, thickeners, and emulsion stabilizers. These alcohols also have surfactant properties, making them valuable in formulations for personal care products. In addition, they are used in the synthesis of esters, surfactants, and lubricants. Pentadecanol’s unique chemical properties make it versatile, enabling its use in diverse formulations and industrial processes.
CAS Number | 4104-59-0 |
Molecular Formula | C15H32O |
Purity | ≥95% |
IUPAC Name | pentadecan-7-ol |
InChI | InChI=1S/C15H32O/c1-3-5-7-9-10-12-14-15(16)13-11-8-6-4-2/h15-16H,3-14H2,1-2H3 |
InChIKey | DTRBNFACZVMDEJ-UHFFFAOYSA-N |
SMILES | CCCCCCCCC(CCCCCC)O |