For research use only. Not for therapeutic Use.
7-Prenyloxycoumarin（Cat No.:R066318）is a naturally occurring coumarin derivative known for its diverse biological properties. Found in various plant species, it features a prenyl group attached to the coumarin structure, enhancing its lipophilicity and biological activity. This compound exhibits antimicrobial, anti-inflammatory, and anticancer potential, making it a subject of interest in pharmaceutical and biochemical research. Its mechanism often involves modulating cellular signaling pathways and exhibiting antioxidant effects. Studies focus on its synthesis, pharmacological applications, and potential use in developing therapeutic agents for chronic and infectious diseases.
| Catalog Number | R066318 |
| CAS Number | 10387-50-5 |
| Molecular Formula | C14H14O3 |
| Purity | ≥95% |
| Target | Fungal |
| Storage | -20°C |
| IUPAC Name | 7-(3-methylbut-2-enoxy)chromen-2-one |
| InChI | InChI=1S/C14H14O3/c1-10(2)7-8-16-12-5-3-11-4-6-14(15)17-13(11)9-12/h3-7,9H,8H2,1-2H3 |
| InChIKey | SMHJTSOVVRGDEO-UHFFFAOYSA-N |
| SMILES | CC(=CCOC1=CC2=C(C=C1)C=CC(=O)O2)C |
