For research use only. Not for therapeutic Use.
7(S),17(S)-Resolvin D5 is a specialized pro-resolving lipid mediator derived from docosahexaenoic acid (DHA). It functions by binding to specific G-protein coupled receptors, promoting the resolution of inflammation and tissue healing. In pharmaceutical chemistry, this compound is of interest for its potential therapeutic applications in treating chronic inflammatory diseases, such as arthritis and cardiovascular disorders. Researchers use it to study the mechanisms of inflammation resolution and develop new anti-inflammatory drugs. Its role in organic chemistry includes synthesis and analysis of bioactive lipids, aiding in the understanding of lipid signaling pathways and the development of novel therapeutic agents.
CAS Number | 578008-43-2 |
Synonyms | (4Z,7S,8E,10Z,13Z,15E,17S,19Z)-7,17-Dihydroxy-4,8,10,13,15,19-docosahexaenoic Acid |
Molecular Formula | C22H32O4 |
Purity | ≥95% |
Target | NF-κB |
Storage | -80°C |
IUPAC Name | (4Z,7S,8E,10Z,13Z,15E,17S,19Z)-7,17-dihydroxydocosa-4,8,10,13,15,19-hexaenoic acid |
InChI | InChI=1S/C22H32O4/c1-2-3-10-15-20(23)16-11-7-5-4-6-8-12-17-21(24)18-13-9-14-19-22(25)26/h3,5-13,16-17,20-21,23-24H,2,4,14-15,18-19H2,1H3,(H,25,26)/b7-5-,8-6-,10-3-,13-9-,16-11+,17-12+/t20-,21+/m0/s1 |
InChIKey | CFOFZYMMJZILHE-XGTWDWJNSA-N |
SMILES | CC/C=C\C[C@@H](/C=C/C=C\C/C=C\C=C\[C@H](C/C=C\CCC(=O)O)O)O |