For research use only. Not for therapeutic Use.
7-(tert-Butoxy)-7-oxoheptanoic acid(CAT: L048804) is a high-purity organic compound featuring a tert-butoxy group and an oxo group at the 7-position of a heptanoic acid backbone. This versatile molecule serves as a valuable intermediate in organic synthesis, particularly in the development of bioactive compounds, such as enzyme inhibitors, therapeutic agents, and specialty chemicals. Its well-defined structure allows for functional group transformations, making it suitable for a variety of chemical applications. 7-(tert-Butoxy)-7-oxoheptanoic acid is a useful building block for medicinal chemistry, fine chemical production, and material science, supporting innovative research and development in these areas.
CAS Number | 1469894-57-2 |
Molecular Formula | C11H20O4 |
Purity | ≥95% |
IUPAC Name | 7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid |
InChI | InChI=1S/C11H20O4/c1-11(2,3)15-10(14)8-6-4-5-7-9(12)13/h4-8H2,1-3H3,(H,12,13) |
InChIKey | QUTDCEYUFAPSIR-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)CCCCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |