For research use only. Not for therapeutic Use.
7,8-Dimethoxychromen-2-one is a compound with diverse biological activities. Found in various plants, it exhibits antioxidant and anti-inflammatory properties. Research indicates its potential in pharmaceutical applications, particularly in drug discovery for treating oxidative stress-related diseases. 7,8-Dimethoxychromen-2-one’s natural occurrence and pharmacological activities make it a subject of interest in medicinal chemistry and natural product research.
CAS Number | 2445-80-9 |
Molecular Formula | C11H10O4 |
Purity | ≥95% |
Target | Disease Research Fields |
IUPAC Name | 7,8-dimethoxychromen-2-one |
InChI | InChI=1S/C11H10O4/c1-13-8-5-3-7-4-6-9(12)15-10(7)11(8)14-2/h3-6H,1-2H3 |
InChIKey | CHBBSMUTOCUVDW-UHFFFAOYSA-N |
SMILES | COC1=C(C2=C(C=C1)C=CC(=O)O2)OC |