For research use only. Not for therapeutic Use.
7,9-Dimesityl-7H-acenaphtho[1,2-d]imidazol-9-ium chloride(CAT: L000403) is a noteworthy compound primarily utilized in the field of organic chemistry. This unique molecule serves as a valuable building block for the synthesis of complex organic compounds and intermediates. Its intricate acenaphthoimidazolium structure plays a pivotal role in diverse organic transformations, allowing for the creation of novel compounds with tailored properties.
CAS Number | 1286737-75-4 |
Molecular Formula | C31H29ClN2 |
Purity | ≥95% |
IUPAC Name | 7,9-bis(2,4,6-trimethylphenyl)acenaphthyleno[1,2-d]imidazol-9-ium;chloride |
InChI | InChI=1S/C31H29N2.ClH/c1-18-13-20(3)28(21(4)14-18)32-17-33(29-22(5)15-19(2)16-23(29)6)31-26-12-8-10-24-9-7-11-25(27(24)26)30(31)32;/h7-17H,1-6H3;1H/q+1;/p-1 |
InChIKey | MOYHJRBGZYOSFI-UHFFFAOYSA-M |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |