For research use only. Not for therapeutic Use.
7BIO (Cat No.:I011464) is a small molecule activator of the AMP-activated protein kinase (AMPK) signaling pathway. AMPK is a critical regulator of cellular energy metabolism, and its activation can improve glucose uptake, lipid metabolism, and mitochondrial biogenesis. 7BIO has been shown to increase the activity of AMPK and induce its downstream effects, which may have therapeutic implications for metabolic disorders such as diabetes and obesity. Additionally, 7BIO has been reported to have anti-inflammatory properties and may have potential in the treatment of inflammatory diseases such as rheumatoid arthritis.
| Catalog Number | I011464 |
| CAS Number | 916440-85-2 |
| Synonyms | 7-bromo-3-[1,3-dihydro-3-(hydroxyimino)-2H-indol-2-ylidene]-1,3-dihydro-2H-indol-2-one |
| Molecular Formula | C16H10BrN3O2 |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 7-bromo-3-(3-nitroso-1H-indol-2-yl)-1H-indol-2-ol |
| InChI | InChI=1S/C16H10BrN3O2/c17-10-6-3-5-9-12(16(21)19-13(9)10)15-14(20-22)8-4-1-2-7-11(8)18-15/h1-7,18-19,21H |
| InChIKey | HYMACPDEJIEMST-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C3=C(NC4=C3C=CC=C4Br)O)N=O |
