For research use only. Not for therapeutic Use.
8α-Hydroxyhirsutinolide(CAT: R061230) is a naturally occurring sesquiterpene lactone found in certain medicinal plants. Known for its anti-inflammatory, antimicrobial, and potential anticancer properties, this compound is studied for its ability to modulate biological pathways, particularly those related to inflammation and cell proliferation. Sesquiterpene lactones like 8α-Hydroxyhirsutinolide are of interest in natural product research due to their capacity to inhibit inflammatory mediators such as cytokines and enzymes. Researchers explore its therapeutic potential in treating diseases linked to chronic inflammation and microbial infections, making it a valuable compound in pharmacology and medicinal chemistry.
CAS Number | 1394156-45-6 |
Molecular Formula | C15H20O6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (1R,2E,8S,10R,11S)-8,11-dihydroxy-6-(hydroxymethyl)-1,10-dimethyl-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-5-one |
InChI | InChI=1S/C15H20O6/c1-8-5-10(17)12-9(7-16)13(18)20-11(12)6-14(2)3-4-15(8,19)21-14/h6,8,10,16-17,19H,3-5,7H2,1-2H3/b11-6+/t8-,10+,14-,15+/m1/s1 |
InChIKey | HGVUPZFNJFDVQM-HEQUYQGPSA-N |
SMILES | CC1CC(C2=C(C(=O)OC2=CC3(CCC1(O3)O)C)CO)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |