For research use only. Not for therapeutic Use.
8-Acetylquinoline is an aromatic compound featuring a quinoline ring with an acetyl group attached at the 8-position. This unique structure enhances its chemical reactivity, making it valuable in organic synthesis and medicinal chemistry. The acetyl group can participate in various transformations, such as nucleophilic additions and condensation reactions. Additionally, the quinoline moiety is known for its potential biological activities, including antimicrobial and anticancer properties. This compound may serve as a key intermediate in developing pharmaceuticals and other functional materials.
| Catalog Number | L047422 |
| CAS Number | 56234-20-9 |
| Molecular Formula | C11H9NO |
| Purity | ≥95% |
| IUPAC Name | 1-quinolin-8-ylethanone |
| InChI | InChI=1S/C11H9NO/c1-8(13)10-6-2-4-9-5-3-7-12-11(9)10/h2-7H,1H3 |
| InChIKey | SHVCKCOMBWIPBE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC2=C1N=CC=C2 |
