Home
>
Chemical Reagents>Heterocyclic Building Blocks> 8-Amino-2,3-dihydrobenzo[b][1,4]dioxine-5-carboxylic acid
For research use only. Not for therapeutic Use.
8-Amino-2,3-dihydrobenzo[b][1,4]dioxine-5-carboxylic acid(Cat No.:L043621)is a heterocyclic compound featuring an amino group at the 8-position and a carboxylic acid group at the 5-position on a dihydrobenzo[b][1,4]dioxine scaffold. This compound is valuable in pharmaceutical research and organic synthesis, serving as a key intermediate in the development of bioactive molecules. Its unique structure allows for versatile chemical transformations, making it essential for the synthesis of potential therapeutic agents and complex organic compounds. 8-Amino-2,3-dihydrobenzo[b][1,4]dioxine-5-carboxylic acid is crucial for advancing medicinal chemistry research.
CAS Number | 66411-22-1 |
Molecular Formula | C9H9NO4 |
Purity | ≥95% |
IUPAC Name | 5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid |
InChI | InChI=1S/C9H9NO4/c10-6-2-1-5(9(11)12)7-8(6)14-4-3-13-7/h1-2H,3-4,10H2,(H,11,12) |
InChIKey | LKYLYFSTNNVQNS-UHFFFAOYSA-N |
SMILES | C1COC2=C(C=CC(=C2O1)C(=O)O)N |