For research use only. Not for therapeutic Use.
8-Azaadenosine(Cat No.:M058953) is a synthetic analog of the naturally occurring nucleoside adenosine, distinguished by the replacement of a carbon atom with nitrogen in the adenine ring. This modification enhances its biological activity, making it a potent modulator of various cellular processes. It has been studied for its potential therapeutic effects, particularly in inhibiting the proliferation of certain cancer cells by impacting metabolic pathways. 8-Azaadenosine also shows promise in regulating immune responses and has been explored in research related to anti-inflammatory and antitumor treatments, offering a potential avenue for novel drug development.
CAS Number | 10299-44-2 |
Molecular Formula | C9H12N6O4 |
Purity | ≥95% |
Target | Adenosine Deaminase |
Storage | -80°C |
IUPAC Name | (2R,3R,4S,5R)-2-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
InChI | InChI=1S/C9H12N6O4/c10-7-4-8(12-2-11-7)15(14-13-4)9-6(18)5(17)3(1-16)19-9/h2-3,5-6,9,16-18H,1H2,(H2,10,11,12)/t3-,5-,6-,9-/m1/s1 |
InChIKey | OAUKGFJQZRGECT-UUOKFMHZSA-N |
SMILES | C1=NC(=C2C(=N1)N(N=N2)C3C(C(C(O3)CO)O)O)N |