For research use only. Not for therapeutic Use.
8-(Benzyloxy)-8-oxooctanoic acid is an organic compound commonly used in pharmaceutical research and organic synthesis. Featuring a benzyloxy group and a keto functionality on an octanoic acid chain, this compound serves as a versatile intermediate for the development of bioactive molecules and drug candidates. Its structure allows for further chemical modifications, making it valuable in synthesizing complex molecules, including those with potential therapeutic applications. This compound contributes to advancements in medicinal chemistry and the design of novel pharmacologically active compounds.
CAS Number | 15570-39-5 |
Molecular Formula | C15H20O4 |
Purity | ≥95% |
IUPAC Name | 8-oxo-8-phenylmethoxyoctanoic acid |
InChI | InChI=1S/C15H20O4/c16-14(17)10-6-1-2-7-11-15(18)19-12-13-8-4-3-5-9-13/h3-5,8-9H,1-2,6-7,10-12H2,(H,16,17) |
InChIKey | KIDAZJWBHFODTB-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |