For research use only. Not for therapeutic Use.
8-Bromo-1-naphthonitrile is an organic compound characterized by a naphthalene ring with a bromine atom substituted at the eighth position and a nitrile group (-C≡N) at the first position. Its chemical formula is C₁₁H₈BrN. This compound is of interest in synthetic organic chemistry and materials science, serving as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. The presence of the bromine and nitrile functionalities enhances its reactivity, making it suitable for diverse chemical transformations and applications in research.
| CAS Number | 1261671-86-6 |
| Molecular Formula | C11H6BrN |
| Purity | ≥95% |
| IUPAC Name | 8-bromonaphthalene-1-carbonitrile |
| InChI | InChI=1S/C11H6BrN/c12-10-6-2-4-8-3-1-5-9(7-13)11(8)10/h1-6H |
| InChIKey | NBDRWCNQCJIOFN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C#N)C(=CC=C2)Br |
