For research use only. Not for therapeutic Use.
8-Bromo-1,2,3,4-tetrahydrocyclopenta[b]indole(Cat No.:L019541)is a valuable intermediate in organic synthesis, particularly in the pharmaceutical and chemical research sectors. This compound, featuring a bromine atom attached to a tetrahydrocyclopenta[b]indole ring system, is highly reactive and serves as a crucial building block for the development of complex heterocyclic compounds. It is often used in the synthesis of active pharmaceutical ingredients (APIs) and other fine chemicals. Its high purity and stability make it an essential tool for researchers and chemists working on innovative compound development and drug discovery projects.
CAS Number | 327022-09-3 |
Molecular Formula | C11H10BrN |
Purity | ≥95% |
IUPAC Name | 8-bromo-1,2,3,4-tetrahydrocyclopenta[b]indole |
InChI | InChI=1S/C11H10BrN/c12-8-4-2-6-10-11(8)7-3-1-5-9(7)13-10/h2,4,6,13H,1,3,5H2 |
InChIKey | AMDPXODFIBNXFR-UHFFFAOYSA-N |
SMILES | C1CC2=C(C1)NC3=C2C(=CC=C3)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |